![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 02. Invincible (feat. Lindsey Stirling).mp3 | 2024-08-10 15:07 | 9.2M | |
| 07. Burn the Bridges.mp3 | 2024-08-10 15:07 | 8.8M | |
| 12. Walk On.mp3 | 2024-08-10 15:07 | 8.5M | |
| 06. Not My Problem (feat. Travis Barker).mp3 | 2024-08-10 15:07 | 8.2M | |
| 11. My Gravity.mp3 | 2024-08-10 15:07 | 8.0M | |
| 04. Chemical Warfare.mp3 | 2024-08-10 15:07 | 7.8M | |
| 10. Ashes (Broken World).mp3 | 2024-08-10 15:07 | 7.5M | |
| 03. Unbreakable.mp3 | 2024-08-10 15:07 | 7.3M | |
| 08. Demons.mp3 | 2024-08-10 15:07 | 7.0M | |
| 01. Lightning Strike.mp3 | 2024-08-10 15:07 | 6.7M | |
| 09. Hand Grenade.mp3 | 2024-08-10 15:07 | 6.5M | |
| 05. Erase You.mp3 | 2024-08-10 15:07 | 6.0M | |
| 15. Over It (Bonus Track).mp3 | 2024-08-10 15:07 | 4.4M | |
| 14. Shut Up and Listen (Bonus Track).mp3 | 2024-08-10 15:07 | 4.1M | |
| 16. Invincible (feat. Lindsey Stirling) (Acoustic) (B-Side).mp3 | 2024-08-10 15:07 | 3.8M | |
| 13. Around the Sun (Bonus Track).mp3 | 2024-08-10 15:07 | 3.3M | |
| 17. Not My Problem (Acoustic) (B-Side).mp3 | 2024-08-10 15:07 | 3.2M | |
| Cover.jpg | 2024-08-10 15:07 | 376K | |
