![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 - Ghost Town.mp3 | 2024-08-10 15:01 | 8.6M | |
| 02 - White Rabbit.mp3 | 2024-08-10 15:01 | 8.3M | |
| 03 - Goodnight.mp3 | 2024-08-10 15:01 | 8.6M | |
| 04 - Kick Ass.mp3 | 2024-08-10 15:01 | 7.6M | |
| 05 - Change.mp3 | 2024-08-10 15:01 | 8.4M | |
| 06 - The Drug, Pt. 1.mp3 | 2024-08-10 15:01 | 7.4M | |
| 07 - Down In Flames.mp3 | 2024-08-10 15:01 | 8.9M | |
| 08 - Enemy Inside, Pt. 2.mp3 | 2024-08-10 15:01 | 9.7M | |
| 09 - Blame.mp3 | 2024-08-10 15:01 | 7.6M | |
| 10 - Dying To Leave.mp3 | 2024-08-10 15:01 | 7.9M | |
| 11 - Surrender.mp3 | 2024-08-10 15:01 | 6.9M | |
| 12 - Backfire.mp3 | 2024-08-10 15:01 | 9.4M | |
| 13 - Liar.mp3 | 2024-08-10 15:01 | 8.0M | |
| 14 - 15 Minutes.mp3 | 2024-08-10 15:01 | 7.5M | |
| cover.jpg | 2024-08-10 15:00 | 824K | |
